Introduction：Basic information about CAS 87606-56-2|2-[[4-[(2-cyanoethyl)ethylamino]phenyl]azo]-5-[(4-nitrophenyl)azo]thiophene-3-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[[4-[(2-cyanoethyl)ethylamino]phenyl]azo]-5-[(4-nitrophenyl)azo]thiophene-3-carbonitrile |
|---|
| CAS Number | 87606-56-2 | Molecular Weight | 458.49600 |
|---|
| Density | 1.36g/cm3 | Boiling Point | 746.3ºC at 760 mmHg |
|---|
| Molecular Formula | C22H18N8O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 405.2ºC |
|---|
Names
| Name | 2-[[4-[2-cyanoethyl(ethyl)amino]phenyl]diazenyl]-5-[(4-nitrophenyl)diazenyl]thiophene-3-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.36g/cm3 |
|---|
| Boiling Point | 746.3ºC at 760 mmHg |
|---|
| Molecular Formula | C22H18N8O2S |
|---|
| Molecular Weight | 458.49600 |
|---|
| Flash Point | 405.2ºC |
|---|
| Exact Mass | 458.12700 |
|---|
| PSA | 174.32000 |
|---|
| LogP | 7.62196 |
|---|
| Index of Refraction | 1.689 |
|---|
| InChIKey | QFUYAFZLCZKYQH-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CCC#N)c1ccc(N=Nc2sc(N=Nc3ccc([N+](=O)[O-])cc3)cc2C#N)cc1 |
|---|
Synonyms
| EINECS 289-324-3 |
| 2-((4-((2-Cyanoethyl)ethylamino)phenyl)azo)-5-((4-nitrophenyl)azo)thiophene-3-carbonitrile |
| 3-Thiophenecarbonitrile,2-[2-[4-[(2-cyanoethyl)ethylamino]phenyl]diazenyl]-5-[2-(4-nitrophenyl)diazenyl] |
| 3-Thiophenecarbonitrile,2-[[4-[(2-cyanoethyl)ethylamino]phenyl]azo]-5-[(4-nitrophenyl)azo]-(9CI) |
