Introduction：Basic information about CAS 57653-29-9|Cogazocine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cogazocine |
|---|
| CAS Number | 57653-29-9 | Molecular Weight | 313.47700 |
|---|
| Density | 1.061g/cm3 | Boiling Point | 430.4ºC at 760mmHg |
|---|
| Molecular Formula | C21H31NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193.4ºC |
|---|
Names
| Name | Cogazocine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.061g/cm3 |
|---|
| Boiling Point | 430.4ºC at 760mmHg |
|---|
| Molecular Formula | C21H31NO |
|---|
| Molecular Weight | 313.47700 |
|---|
| Flash Point | 193.4ºC |
|---|
| Exact Mass | 313.24100 |
|---|
| PSA | 23.47000 |
|---|
| LogP | 4.43460 |
|---|
| Index of Refraction | 1.559 |
|---|
| InChIKey | IUUBFDSJJHOTDI-UHFFFAOYSA-N |
|---|
| SMILES | CCC12CCN(CC3CCC3)C(Cc3ccc(O)cc31)C2(C)C |
|---|
Synonyms
| Cogazocina |
| UNII-6GKB767I3M |
| Cogazocinum |
