Introduction：Basic information about CAS 1947-47-3|3-amino-2-phenylindenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-amino-2-phenylindenone |
|---|
| CAS Number | 1947-47-3 | Molecular Weight | 221.25400 |
|---|
| Density | 1.256g/cm3 | Boiling Point | 405.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H11NO | Melting Point | 271-273°C |
|---|
| MSDS | USA | Flash Point | 198.8ºC |
|---|
Names
| Name | 3-amino-2-phenylinden-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.256g/cm3 |
|---|
| Boiling Point | 405.1ºC at 760mmHg |
|---|
| Melting Point | 271-273°C |
|---|
| Molecular Formula | C15H11NO |
|---|
| Molecular Weight | 221.25400 |
|---|
| Flash Point | 198.8ºC |
|---|
| Exact Mass | 221.08400 |
|---|
| PSA | 43.09000 |
|---|
| LogP | 3.41020 |
|---|
| Vapour Pressure | 4.09E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | HLEKBTIHDXNOQP-UHFFFAOYSA-N |
|---|
| SMILES | NC1=C(c2ccccc2)C(=O)c2ccccc21 |
|---|
Safety Information
| Risk Phrases | 43 |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| HS Code | 2922399090 |
|---|
Customs
| HS Code | 2922399090 |
|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-amino-2-phenyl-1-inden-1-one |
| 3-Amino-2-phenylindenone |
| 3-Amino-2-phenyl-inden-1-on |
| 3-amino-2-phenylindan-1-one |
| 3-amino-2-phenyl-inden-1-one |
| MFCD00051614 |
| 3-Amino-2-phenyl-1H-inden-1-one |
