Introduction：Basic information about CAS 140369-67-1|(4'-Fluoro-4-biphenylyl)boronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4'-Fluoro-4-biphenylyl)boronic acid |
|---|
| CAS Number | 140369-67-1 | Molecular Weight | 216.016 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 382.3±44.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H10BFO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 185.0±28.4 °C |
|---|
Names
| Name | 4-(4-Fluorophenyl)phenylboronic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 382.3±44.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H10BFO2 |
|---|
| Molecular Weight | 216.016 |
|---|
| Flash Point | 185.0±28.4 °C |
|---|
| Exact Mass | 216.075790 |
|---|
| PSA | 40.46000 |
|---|
| LogP | 3.28 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | KHMFYFVXTICBEL-UHFFFAOYSA-N |
|---|
| SMILES | OB(O)c1ccc(-c2ccc(F)cc2)cc1 |
|---|
Synonyms
| [4-(4-fluorophenyl)phenyl]boronic acid |
| 4'-Fluorobiphenyl-4-boronic acid |
| (4'-Fluorobiphenyl-4-yl)boronic acid |
| Boronic acid, B-(4'-fluoro[1,1'-biphenyl]-4-yl)- |
| (4'-Fluoro-4-biphenylyl)boronic acid |
