Introduction：Basic information about CAS 126208-61-5|5-Amino-3-tert-butyl-1-phenylpyrazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Amino-3-tert-butyl-1-phenylpyrazole |
|---|
| CAS Number | 126208-61-5 | Molecular Weight | 215.294 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 356.3±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H17N3 | Melting Point | 59-61ºC |
|---|
| MSDS | USA | Flash Point | 169.3±24.6 °C |
|---|
Names
| Name | 5-tert-butyl-2-phenylpyrazol-3-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 356.3±30.0 °C at 760 mmHg |
|---|
| Melting Point | 59-61ºC |
|---|
| Molecular Formula | C13H17N3 |
|---|
| Molecular Weight | 215.294 |
|---|
| Flash Point | 169.3±24.6 °C |
|---|
| Exact Mass | 215.142242 |
|---|
| PSA | 43.84000 |
|---|
| LogP | 3.19 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | GFWSTBBSSBVVQP-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc(N)n(-c2ccccc2)n1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 22 |
|---|
| HS Code | 2933199090 |
|---|
Customs
| HS Code | 2933199090 |
|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1H-Pyrazol-5-amine, 3-(1,1-dimethylethyl)-1-phenyl- |
| 5-Amino-3-tert-butyl-1-phenylpyrazole |
| 3-amino-5-tert-butyl-2-phenyl-2H-pyrazole |
| 5-amino-1-phenyl-3-tert-butylpyrazole |
| 5-tert-Butyl-2-phenyl-2H-pyrazol-3-ylamine |
| 3-(2-Methyl-2-propanyl)-1-phenyl-1H-pyrazol-5-amine |
| 5-amino-3-t-butyl-1-phenylpyrazole |
| 5-amino-3-tert-butyl-1-phenyl-1H-pyrazole |
| MFCD02091535 |
| 3-(2-Methyl-2-propanyl)-1-phenyl-1H-pyrazol-5-amin |
| 3-tert-Butyl-1-phenyl-1H-pyrazol-5-amine |
