Introduction：Basic information about CAS 5461-32-5|2-Nitrophenylpyruvic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Nitrophenylpyruvic acid |
|---|
| CAS Number | 5461-32-5 | Molecular Weight | 209.156 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 379.7±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7NO5 | Melting Point | 119-120 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 168.6±11.6 °C |
|---|
Names
| Name | 2-Nitrophenylpyruvic Acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 379.7±25.0 °C at 760 mmHg |
|---|
| Melting Point | 119-120 °C(lit.) |
|---|
| Molecular Formula | C9H7NO5 |
|---|
| Molecular Weight | 209.156 |
|---|
| Flash Point | 168.6±11.6 °C |
|---|
| Exact Mass | 209.032425 |
|---|
| PSA | 100.19000 |
|---|
| LogP | 0.27 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | CGCWRLDEYHZQCW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(=O)Cc1ccccc1[N+](=O)[O-] |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Pyruvic acid, (o-nitrophenyl)- |
| EINECS 226-746-9 |
| MFCD00007191 |
| 3-(2-Nitrophenyl)-2-oxopropanoic acid |
| Benzenepropanoic acid, 2-nitro-α-oxo- |
| 2-Nitrophenylpyruvic acid |
