Introduction:Basic information about CAS 3566-44-7|Variamine Blue B [Redox Indicator], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Variamine Blue B [Redox Indicator] |
|---|
| CAS Number | 3566-44-7 | Molecular Weight | 250.72400 |
|---|
| Density | 1.178g/cm3 | Boiling Point | 388.7ºC at 760mmHg |
|---|
| Molecular Formula | C13H15ClN2O | Melting Point | 249-255 °C(lit.) |
|---|
| MSDS | / | Flash Point | 188.9ºC |
|---|
Names
| Name | variamine blue b |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.178g/cm3 |
|---|
| Boiling Point | 388.7ºC at 760mmHg |
|---|
| Melting Point | 249-255 °C(lit.) |
|---|
| Molecular Formula | C13H15ClN2O |
|---|
| Molecular Weight | 250.72400 |
|---|
| Flash Point | 188.9ºC |
|---|
| Exact Mass | 250.08700 |
|---|
| PSA | 47.28000 |
|---|
| LogP | 4.47720 |
|---|
| InChIKey | HPQQXLXIGHOKNZ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Nc2ccc(N)cc2)cc1.Cl |
|---|
Safety Information
| Hazard Codes | T: Toxic; |
|---|
| Risk Phrases | R23/24/25 |
|---|
| Safety Phrases | S36/37/39-S45 |
|---|
| RIDADR | UN 2811 6.1/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1(b) |
|---|
| HS Code | 2922299090 |
|---|
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| MFCD00012989 |
| 4-Amino-4'-methoxydiphenylamine Hydrochloride |
| N-(4-Methoxyphenyl)-p-phenylenediamine hydrochloride |
| Variamine Blue B [Redox Indicator] |
| Variamineblue |
| VARIAMINE BLUE HYDROCHLORIDE |
| Variamine Blue B Hydrochloride |
| EINECS 222-652-7 |
| N-(4-Methoxyphenyl)-1,4-phenylenediamine Hydrochloride |
| Variaminblau |
| N-Methyl-p-phenylenediamineHCl |