Introduction:Basic information about CAS 35350-31-3|Disulfide,bis(4-methyl-2-nitrophenyl), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Disulfide,bis(4-methyl-2-nitrophenyl) |
|---|
| CAS Number | 35350-31-3 | Molecular Weight | 336.38600 |
|---|
| Density | 1.44g/cm3 | Boiling Point | 480.6ºC at 760mmHg |
|---|
| Molecular Formula | C14H12N2O4S2 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 244.4ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-nitro-p-tolyl disulfide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.44g/cm3 |
|---|
| Boiling Point | 480.6ºC at 760mmHg |
|---|
| Molecular Formula | C14H12N2O4S2 |
|---|
| Molecular Weight | 336.38600 |
|---|
| Flash Point | 244.4ºC |
|---|
| Exact Mass | 336.02400 |
|---|
| PSA | 142.24000 |
|---|
| LogP | 5.96560 |
|---|
| Index of Refraction | 1.686 |
|---|
| InChIKey | MBTLEECRJWKPIP-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(SSc2ccc(C)cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2930909090 |
|---|
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 1,1'-Dithiobis(2-nitro-4-methylbenzene) |
| MFCD00087053 |
| 2.2'-Dinitro-4.4'-dimethyl-diphenyldisulfid |
| Bis-<4-methyl-2-nitrophenyl>-disulfid |
| Bis(4-methyl-2-nitrophenyl) persulfide |
| DI(4-METHYL-2-NITROPHENYL) DISULFIDE |
| disulfide,bis(4-methyl-2-nitrophenyl) |
| 4,4'-DIMETHYL-2,2'-DINITRO-DIPHENYLDISULFIDE |
| bis-(4-methyl-2-nitro-phenyl)-disulfane |
| AURORA KA-81 |
| bis-(4-methyl-2-nitrophenyl)disulfide |
| 1,1'-Dithiobis(4-methyl-2-nitrobenzene) |