Introduction：Basic information about CAS 128-65-4|2,9-diphenylanthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,9-diphenylanthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetrone |
|---|
| CAS Number | 128-65-4 | Molecular Weight | 542.53900 |
|---|
| Density | 1.546g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C36H18N2O4 | Melting Point | >300ºC |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | PTCDI-Ph |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.546g/cm3 |
|---|
| Melting Point | >300ºC |
|---|
| Molecular Formula | C36H18N2O4 |
|---|
| Molecular Weight | 542.53900 |
|---|
| Exact Mass | 542.12700 |
|---|
| PSA | 78.14000 |
|---|
| LogP | 5.94140 |
|---|
| Index of Refraction | 1.89 |
|---|
| InChIKey | OGEZSLXPCKHGKO-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C(=O)N1c1ccccc1)c64)C(=O)N(c1ccccc1)C5=O |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Perylene-3,4,9,10-tetracarboxylic acid N,N'-diphenyldiimide |
| N,N'-Diphenyl-3,4,9,10-perylenedicarboximide |
| MFCD00151605 |
| 2,9-Diphenyl-anthra[2,1,9-def,6,5,10-d'e'f']diisochinolin-1,3,8,10-tetraon |
| 2,9-diphenyl-anthra[2,1,9-def,6,5,10-d'e'f']diisoquinoline-1,3,8,10-tetraone |
| N,N'-diphenyl-3,4,9,10-perylenetetracarboxylic diimide |
| 2,9-Diphenylanthra(2,1,9-def:6,5,10-d'e'f')diisoquinoline-1,3,8,10(2H,9H)-tetrone |
| EINECS 204-902-7 |
