Introduction：Basic information about CAS 1561-49-5|dicyclohexyl peroxydicarbonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dicyclohexyl peroxydicarbonate |
|---|
| CAS Number | 1561-49-5 | Molecular Weight | 204.17700 |
|---|
| Density | 1.18g/cm3 | Boiling Point | 349.9ºC at 760mmHg |
|---|
| Molecular Formula | C8H12O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 150.9ºC |
|---|
Names
| Name | Dicyclohexyl peroxydicarbonate(technically pure) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.18g/cm3 |
|---|
| Boiling Point | 349.9ºC at 760mmHg |
|---|
| Molecular Formula | C8H12O6 |
|---|
| Molecular Weight | 204.17700 |
|---|
| Flash Point | 150.9ºC |
|---|
| Exact Mass | 204.06300 |
|---|
| PSA | 82.06000 |
|---|
| LogP | 2.08190 |
|---|
| Vapour Pressure | 4.56E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.489 |
|---|
| InChIKey | BLCKNMAZFRMCJJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OOC(=O)OC1CCCCC1)OC1CCCCC1 |
|---|
Safety Information
| RIDADR | UN 3112 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 5.2 |
|---|
| HS Code | 2909600000 |
|---|
Customs
| HS Code | 2909600000 |
|---|
| Summary | 2909600000 alcohol peroxides, ether peroxides, ketone peroxides and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| Dicyclohexyl perdicarbonate |
| dicyclohexyl peroxidicarbonate |
| EINECS 216-337-3 |
| cyclohexyl percarbonate |
| Di-n-octanoyl peroxide(technically pure) |
| Peroxydicarbonic acid dicyclohexyl |
| dicyclohexlperoxydicarbonate |
| di-n-octanoyl peroxide,technical pure |
| cyclohexyl cyclohexyloxycarbonyloxy carbonate |
| Bis(cyclohexyloxycarbonyl) peroxide |
| dicyclohexylperoxy dicarbonate |
| Peroxydicarbonic Acid Dicyclohexyl Ester |
| Peroxybis(formic acid cyclohexyl) ester |
