Introduction:Basic information about CAS 1939-27-1|N-(3-(Trifluoromethyl)phenyl)isobutyramide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(3-(Trifluoromethyl)phenyl)isobutyramide |
|---|
| CAS Number | 1939-27-1 | Molecular Weight | 231.21400 |
|---|
| Density | 1.22 g/cm3 | Boiling Point | 313.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12F3NO | Melting Point | 100-101ºC |
|---|
| MSDS | / | Flash Point | 143.4°C |
|---|
Names
| Name | 3'-Trifluoromethylisobutyranilide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.22 g/cm3 |
|---|
| Boiling Point | 313.5ºC at 760 mmHg |
|---|
| Melting Point | 100-101ºC |
|---|
| Molecular Formula | C11H12F3NO |
|---|
| Molecular Weight | 231.21400 |
|---|
| Flash Point | 143.4°C |
|---|
| Exact Mass | 231.08700 |
|---|
| PSA | 29.10000 |
|---|
| LogP | 3.37290 |
|---|
| Vapour Pressure | 0.000493mmHg at 25°C |
|---|
| Index of Refraction | 1.489 |
|---|
| InChIKey | GETMKVRSDFVVHL-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)C(=O)Nc1cccc(C(F)(F)F)c1 |
|---|
Safety Information
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
|---|
| Risk Phrases | R48/22 |
|---|
| Safety Phrases | 22-36-61 |
|---|
Synonyms
| MFCD00043455 |
| 2-methyl-N-[3-(trifluoromethyl)phenyl]propionamide |
| 2-METHYL-N-(3-TRIFLUOROMETHYLPHENYL) PROPANAMIDE |
| EINECS 406-740-4 |
| Isobuttersaeure-(3-trifluormethyl-anilid) |
| 3-(Isobutyryladmino)-1-(trifluoro-methyl)benzene |
| m-trifluoromethyl isobutyranilide |
| Ethanone,1-(2-hydroxy-4,5-dimethylphenyl) |
| 3-trifluoromethylisobutyranilide |
| 3-Isobutyrylamino-1-trifluormethyl-benzol |
| isobutyric acid-(3-trifluoromethyl-anilide) |
| PropanaMide,2-Methyl-N-[3-(trifluoroMethyl)phenyl] |
| 2-Methyl-N-(a,a,a-trifluoro-M-tolyl)propionaMide |