Introduction:Basic information about CAS 67259-63-6|4-[4-(trifluoromethyl)phenyl]piperidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[4-(trifluoromethyl)phenyl]piperidine |
|---|
| CAS Number | 67259-63-6 | Molecular Weight | 229.24100 |
|---|
| Density | 1.145 | Boiling Point | 276ºC |
|---|
| Molecular Formula | C12H14F3N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 121ºC |
|---|
Names
| Name | 4-[4-(trifluoromethyl)phenyl]piperidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.145 |
|---|
| Boiling Point | 276ºC |
|---|
| Molecular Formula | C12H14F3N |
|---|
| Molecular Weight | 229.24100 |
|---|
| Flash Point | 121ºC |
|---|
| Exact Mass | 229.10800 |
|---|
| PSA | 12.03000 |
|---|
| LogP | 3.50120 |
|---|
| Index of Refraction | 1.469 |
|---|
| InChIKey | AKGAUMQWPLQYHW-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1ccc(C2CCNCC2)cc1 |
|---|
Synonyms
| 4-(4-(trifluoromethyl)phenyl)piperidine |
| 4-(4-CF3-phenyl)piperidine |
| 4-(4-Trifloromethylphenyl)piperidine |