Introduction：Basic information about CAS 260273-82-3|3-(2-Chloroethyl)-9-hydroxy-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(2-Chloroethyl)-9-hydroxy-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one |
|---|
| CAS Number | 260273-82-3 | Molecular Weight | 238.670 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 413.1±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H11ClN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 203.6±31.5 °C |
|---|
Names
| Name | 3-(2-Chloroethyl)-2-methyl-9-hydroxy-4H-pyrido[1,2-a]pyrimidin-4-one (Paliperidone) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 413.1±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H11ClN2O2 |
|---|
| Molecular Weight | 238.670 |
|---|
| Flash Point | 203.6±31.5 °C |
|---|
| Exact Mass | 238.050903 |
|---|
| PSA | 54.60000 |
|---|
| LogP | 1.66 |
|---|
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | NMALKTKBJPTUDK-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc2c(O)cccn2c(=O)c1CCCl |
|---|
Synonyms
| 4H-Pyrido[1,2-a]pyrimidin-4-one, 3-(2-chloroethyl)-9-hydroxy-2-methyl- |
| 3-(2-chloroethyl)-9-hydroxy-2-methyl-4H-pyrido[1,2-a]pyrimidine-4-one |
| 3-(2-Chloroethyl)-2-methyl-9-hydroxy-4H-pyrido[1,2-a]pyrimidin-4-one(Paliperidone) |
| 3-(2-chloroethyl)-2-methyl-9-hydroxy-4H-pyrido[1,2-a]pyrimidin-4-one |
| 3-(2-chloroethyl)-2-Methyl-9-hydroxy-4H-pyrido[1,2-a]pyriMidine-4-one |
| 9-hydroxy-3-(2-chloroethyl)-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one |
| 3-(2-chloroethyl)-6,7,8,9-tetrahydro-9-hydroxy-2- methyl-4H-pyrido [1,2-a]pyrimidine-4-one |
| MFCD11110969 |
