Introduction：Basic information about CAS 5419-82-9|2-Acetamido-1-Nitronaphthalene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Acetamido-1-Nitronaphthalene |
|---|
| CAS Number | 5419-82-9 | Molecular Weight | 230.21900 |
|---|
| Density | 1.366 | Boiling Point | 474.1ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-Acetamido-1-Nitronaphthalene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.366 |
|---|
| Boiling Point | 474.1ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10N2O3 |
|---|
| Molecular Weight | 230.21900 |
|---|
| Exact Mass | 230.06900 |
|---|
| PSA | 74.92000 |
|---|
| LogP | 3.30260 |
|---|
| Index of Refraction | 1.697 |
|---|
| InChIKey | ZDOWETIOQWADNW-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc2ccccc2c1[N+](=O)[O-] |
|---|
Synonyms
| N-Acetyl-1-nitro-naphthylamin-(2) |
| 1-Nitro-2-acetamino-naphthalin |
| N-(1-nitronaphthalen-2-yl)acetamide |
| 1-nitro-2-acetylaminonaphthalene |
| N-(1-nitro-2-naphthalenyl)-acetamide |
| N-(1-nitronaphthalen-2-yl)ethanamide |
| N-(1-nitro-[2]naphthyl)-acetamide |
