Introduction:Basic information about CAS 14804-39-8|2,6-Dimethyl-4-nitroanisole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Dimethyl-4-nitroanisole |
|---|
| CAS Number | 14804-39-8 | Molecular Weight | 181.189 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 299.6±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H11NO3 | Melting Point | 85-89ºC |
|---|
| MSDS | / | Flash Point | 138.7±27.9 °C |
|---|
Names
| Name | 2-methoxy-1,3-dimethyl-5-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 299.6±35.0 °C at 760 mmHg |
|---|
| Melting Point | 85-89ºC |
|---|
| Molecular Formula | C9H11NO3 |
|---|
| Molecular Weight | 181.189 |
|---|
| Flash Point | 138.7±27.9 °C |
|---|
| Exact Mass | 181.073898 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 2.95 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.535 |
|---|
| InChIKey | HSDNHFOJTRMGER-UHFFFAOYSA-N |
|---|
| SMILES | COc1c(C)cc([N+](=O)[O-])cc1C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2,6-Dimethyl-4-nitro-anisol |
| 2,6-Dimethyl-4-nitroanisole |
| 4-nitro-2,6-dimethylanisole |
| 2,6-Dimethyl-4-nitrophenyl methyl ether |
| 2-Methoxy-1,3-dimethyl-5-nitrobenzene |
| 3,5-Dimethyl-4-methoxynitrobenzene |
| m-Xylene,2-methoxy-5-nitro |
| 2-Methoxy-5-nitro-m-xylene |
| Benzene, 2-methoxy-1,3-dimethyl-5-nitro- |
| m-Xylene, 2-methoxy-5-nitro- |
| WNR C1 E1 DO1 |
| 4-methoxy-3,5-dimethylnitrobenzene |