Introduction:Basic information about CAS 3007-23-6|1H-Pyrrole-2,5-dione,1-(3-methoxyphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Pyrrole-2,5-dione,1-(3-methoxyphenyl)- |
|---|
| CAS Number | 3007-23-6 | Molecular Weight | 203.19400 |
|---|
| Density | 1.317g/cm3 | Boiling Point | 358.5ºC at 760mmHg |
|---|
| Molecular Formula | C11H9NO3 | Melting Point | 62ºC |
|---|
| MSDS | / | Flash Point | 170.6ºC |
|---|
Names
| Name | 1-(3-methoxyphenyl)pyrrole-2,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.317g/cm3 |
|---|
| Boiling Point | 358.5ºC at 760mmHg |
|---|
| Melting Point | 62ºC |
|---|
| Molecular Formula | C11H9NO3 |
|---|
| Molecular Weight | 203.19400 |
|---|
| Flash Point | 170.6ºC |
|---|
| Exact Mass | 203.05800 |
|---|
| PSA | 46.61000 |
|---|
| LogP | 1.18960 |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | UNCUTNPWBZKJHD-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc(N2C(=O)C=CC2=O)c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| HS Code | 2925190090 |
|---|
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 1-(3-Methoxy-phenyl)-pyrrole-2,5-dione |
| N-(3-Methoxyphenyl)maleimide |
| 1-(3-methoxyphenyl)azoline-2,5-dione |
| N-(m-Methoxyphenyl)-maleinimid |
| MFCD00090444 |
| 1-(3-methoxyphenyl)-2,5-dihydro-1H-pyrrole-2,5-dione |
| 1-(3-methoxyphenyl)maleimide |
| N-m-Methoxyphenylmaleimid |
| 1-(3-Methoxyphenyl)-1H-pyrrole-2,5-dione |