Introduction：Basic information about CAS 845885-89-4|4-CHLORO-2-IODOTOLUENE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-CHLORO-2-IODOTOLUENE |
|---|
| CAS Number | 845885-89-4 | Molecular Weight | 255.31500 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 458.4ºC at 760 mmHg |
|---|
| Molecular Formula | C15H17N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 231ºC |
|---|
Names
| Name | (4-imidazol-1-ylphenyl)-piperidin-4-ylmethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 458.4ºC at 760 mmHg |
|---|
| Molecular Formula | C15H17N3O |
|---|
| Molecular Weight | 255.31500 |
|---|
| Flash Point | 231ºC |
|---|
| Exact Mass | 255.13700 |
|---|
| PSA | 46.92000 |
|---|
| LogP | 2.38340 |
|---|
| Index of Refraction | 1.647 |
|---|
| InChIKey | HMSOFTWOECICPS-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1ccc(-n2ccnc2)cc1)C1CCNCC1 |
|---|
Synonyms
| (4-Imidazol-1-yl-phenyl)-piperidin-4-yl-methanone |
| 4-imidazolylphenyl 4-piperidyl ketone |
| 4-[4-(imidazol-1-yl)benzoyl]piperidine |
