Introduction：Basic information about CAS 423768-39-2|5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]thiophene-2-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]thiophene-2-sulfonyl chloride |
|---|
| CAS Number | 423768-39-2 | Molecular Weight | 299.15400 |
|---|
| Density | 1.682g/cm3 | Boiling Point | 471.5ºC at 760 mmHg |
|---|
| Molecular Formula | C7H4Cl2N2O3S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 239ºC |
|---|
Names
| Name | 5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]thiophene-2-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.682g/cm3 |
|---|
| Boiling Point | 471.5ºC at 760 mmHg |
|---|
| Molecular Formula | C7H4Cl2N2O3S2 |
|---|
| Molecular Weight | 299.15400 |
|---|
| Flash Point | 239ºC |
|---|
| Exact Mass | 297.90400 |
|---|
| PSA | 109.68000 |
|---|
| LogP | 3.54520 |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | SBJSVTQEOYREFW-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1ccc(-c2noc(CCl)n2)s1 |
|---|
Safety Information
| Hazard Codes | C:Corrosive |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
Synonyms
| QC-8244 |
| 5-(5-(chloromethyl)-1,2,4-oxadiazol-3-yl)thiophene-2-sulfonyl chloride |
| 5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-2-thiophenesulphonyl chloride |
