Introduction：Basic information about CAS 70565-23-0|1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]ethanone |
|---|
| CAS Number | 70565-23-0 | Molecular Weight | 270.11100 |
|---|
| Density | 1.334g/cm3 | Boiling Point | 379.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9Cl2NO2 | Melting Point | 72ºC |
|---|
| MSDS | / | Flash Point | 183.5ºC |
|---|
Names
| Name | 1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.334g/cm3 |
|---|
| Boiling Point | 379.8ºC at 760 mmHg |
|---|
| Melting Point | 72ºC |
|---|
| Molecular Formula | C12H9Cl2NO2 |
|---|
| Molecular Weight | 270.11100 |
|---|
| Flash Point | 183.5ºC |
|---|
| Exact Mass | 269.00100 |
|---|
| PSA | 43.10000 |
|---|
| LogP | 4.15940 |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | OTOMALVKPCXLLJ-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1c(-c2c(Cl)cccc2Cl)noc1C |
|---|
Synonyms
| hms566f09 |
| 1-[3-(2,6-dichloro-phenyl)-5-methyl-isoxazol-4-yl]-ethanone |
