Introduction：Basic information about CAS 429689-17-8|(S)-METHYL3-(4-HYDROXY-3-NITROPHENYL)-2-(2,2,2-TRIFLUOROACETYLAMINO)PROPIONAT, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-METHYL3-(4-HYDROXY-3-NITROPHENYL)-2-(2,2,2-TRIFLUOROACETYLAMINO)PROPIONATE |
|---|
| CAS Number | 429689-17-8 | Molecular Weight | 293.36000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H19NO2 | Melting Point | 89-93ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | methyl (3S)-3-(1-methylindol-3-yl)-3-phenylpropanoate |
|---|
Chemical & Physical Properties
| Melting Point | 89-93ºC(lit.) |
|---|
| Molecular Formula | C19H19NO2 |
|---|
| Molecular Weight | 293.36000 |
|---|
| Exact Mass | 293.14200 |
|---|
| PSA | 31.23000 |
|---|
| LogP | 3.87330 |
|---|
| InChIKey | NFIUVSIKIXOXQK-INIZCTEOSA-N |
|---|
| SMILES | COC(=O)CC(c1ccccc1)c1cn(C)c2ccccc12 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H317-H319 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn |
|---|
| RIDADR | NONH for all modes of transport |
|---|
