Introduction:Basic information about CAS 195062-62-5|4-Ethoxycarbonylphenylboronic acid pinacol ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Ethoxycarbonylphenylboronic acid pinacol ester |
|---|
| CAS Number | 195062-62-5 | Molecular Weight | 276.13600 |
|---|
| Density | 1.052g/mLat25ºC(lit.) | Boiling Point | 330ºC(lit.) |
|---|
| Molecular Formula | C15H21BO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | >230 |
|---|
Names
| Name | ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.052g/mLat25ºC(lit.) |
|---|
| Boiling Point | 330ºC(lit.) |
|---|
| Molecular Formula | C15H21BO4 |
|---|
| Molecular Weight | 276.13600 |
|---|
| Flash Point | >230 |
|---|
| Exact Mass | 276.15300 |
|---|
| PSA | 44.76000 |
|---|
| LogP | 2.16250 |
|---|
| Vapour Pressure | 1.12E-05mmHg at 25°C |
|---|
| Index of Refraction | n20/D 1.5(lit.) |
|---|
| InChIKey | NCVIYKCFTYSAGN-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
|---|
| Storage condition | Refrigerator (+4°C) |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-benzoic acid ethyl ester |
| 4-Ethoxycarbonylphenylboronic acid pinacol ester |
| 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolane-2-yl)benzoic acid ethyl ester |
| ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborol-2-yl)benzoate |
| 2-(4-ethoxycarbonylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| BM037 |
| ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolyl)benzoate |
| 4-Carboethoxyphenylboronic acid pinacol ester |
| MFCD02683499 |