Introduction：Basic information about CAS 111160-56-6|(2,3-Dihydro-2-thioxo-3-benzoxazolyl)phosphonic acid diphenyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2,3-Dihydro-2-thioxo-3-benzoxazolyl)phosphonic acid diphenyl ester |
|---|
| CAS Number | 111160-56-6 | Molecular Weight | 383.35800 |
|---|
| Density | 1.45g/cm3 | Boiling Point | 497ºC at 760 mmHg |
|---|
| Molecular Formula | C19H14NO4PS | Melting Point | 84ºC |
|---|
| MSDS | / | Flash Point | 254.4ºC |
|---|
Names
| Name | 3-diphenoxyphosphoryl-1,3-benzoxazole-2-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.45g/cm3 |
|---|
| Boiling Point | 497ºC at 760 mmHg |
|---|
| Melting Point | 84ºC |
|---|
| Molecular Formula | C19H14NO4PS |
|---|
| Molecular Weight | 383.35800 |
|---|
| Flash Point | 254.4ºC |
|---|
| Exact Mass | 383.03800 |
|---|
| PSA | 95.50000 |
|---|
| LogP | 6.07800 |
|---|
| Vapour Pressure | 5.13E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.701 |
|---|
| InChIKey | POSVXIWJQXSIIP-UHFFFAOYSA-N |
|---|
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)n1c(=S)oc2ccccc21 |
|---|
Safety Information
Synonyms
| Diphenyl (2,3-Dihydro-2-thioxo-3-benzoxazolyl)phosphonate |
| (2,3-Dihydro-2-thioxo-3-benzoxazolyl)phosphonic Acid Diphenyl Ester |
| diphenyl (2,3-dihydro-2-thioxo-3-benzoxazoyl)phosphonate |
| 2,3-dihydro-2-thioxo-3-benzoxazolyl-P(O)(OPh)2 |
