Introduction:Basic information about CAS 1988-88-1|3,5-di-tert-Butyl-4-hydroxybenzonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-di-tert-Butyl-4-hydroxybenzonitrile |
|---|
| CAS Number | 1988-88-1 | Molecular Weight | 231.33300 |
|---|
| Density | 1.01g/cm3 | Boiling Point | 311.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H21NO | Melting Point | 144 °C |
|---|
| MSDS | / | Flash Point | 142ºC |
|---|
Names
| Name | 3,5-ditert-butyl-4-hydroxybenzonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.01g/cm3 |
|---|
| Boiling Point | 311.2ºC at 760 mmHg |
|---|
| Melting Point | 144 °C |
|---|
| Molecular Formula | C15H21NO |
|---|
| Molecular Weight | 231.33300 |
|---|
| Flash Point | 142ºC |
|---|
| Exact Mass | 231.16200 |
|---|
| PSA | 44.02000 |
|---|
| LogP | 3.85888 |
|---|
| Vapour Pressure | 0.000313mmHg at 25°C |
|---|
| Index of Refraction | 1.523 |
|---|
| InChIKey | AKXIIOLURNATOC-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc(C#N)cc(C(C)(C)C)c1O |
|---|
Safety Information
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | 3276 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2926909090 |
|---|
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| <3,5-di(tert-butyl)>-4-hydroxybenzoic acid nitrile |
| 2,6-di-tert-butyl-4-cyanophenol |
| Benzonitrile,3,5-di-tert-butyl-4-hydroxy |
| 3,5-bis(tert-butyl)-4-hydroxybenzenecarbonitrile |
| 3,5-DI-TERT-BUTYL-4-HYDROXYBENZONITRILE |
| 4-hydroxy-3,5-di-tert-butylbenzonitrile |
| Benzonitrile,3,5-bis(1,1-dimethylethyl)-4-hydroxy |
| 2,6-di-t-butyl-4-cyanophenol |
| 3,5-Di(tert-butyl)-4-hydroxybenzonitrile |
| 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzonitrile |
| MFCD00156137 |