Introduction：Basic information about CAS 85301-66-2|3-(trifluoromethyl)benzal chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(trifluoromethyl)benzal chloride |
|---|
| CAS Number | 85301-66-2 | Molecular Weight | 229.02700 |
|---|
| Density | 1.407g/cm3 | Boiling Point | 92/15mm |
|---|
| Molecular Formula | C8H5Cl2F3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 87.2ºC |
|---|
Names
| Name | 3-(trifluoromethyl)benzal chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.407g/cm3 |
|---|
| Boiling Point | 92/15mm |
|---|
| Molecular Formula | C8H5Cl2F3 |
|---|
| Molecular Weight | 229.02700 |
|---|
| Flash Point | 87.2ºC |
|---|
| Exact Mass | 227.97200 |
|---|
| LogP | 4.18160 |
|---|
| Index of Refraction | 1.475 |
|---|
| InChIKey | YHSJPSUQWJNGQJ-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1cccc(C(Cl)Cl)c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
Synonyms
| mtf-bac |
| m-trifluoromethylbenzal chloride |
