Introduction：Basic information about CAS 158257-40-0|Fmoc-sta-oh, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-sta-oh |
|---|
| CAS Number | 158257-40-0 | Molecular Weight | 397.464 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 618.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H27NO5 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 327.7±31.5 °C |
|---|
Names
| Name | (3S,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-6-methylheptanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 618.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H27NO5 |
|---|
| Molecular Weight | 397.464 |
|---|
| Flash Point | 327.7±31.5 °C |
|---|
| Exact Mass | 397.188934 |
|---|
| PSA | 95.86000 |
|---|
| LogP | 2.89 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | JGUYYODGVQXZAY-SFTDATJTSA-N |
|---|
| SMILES | CC(C)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(O)CC(=O)O |
|---|
| Storage condition | -20°C |
|---|
Safety Information
Synonyms
| Fmoc-Sta-OH |
| (3S,4S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxy-6-methylheptanoic acid |
| AmbotzFAA1630 |
| Heptanoic acid, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-3-hydroxy-6-methyl-, (3S,4S)- |
| Fmoc-L-Statine |
| MFCD00065675 |
| fmoc-(3s,4s)sta-oh |
| N-Fmoc-statine |
| N-FMOC-L-Statine |
| 4-Amino-8-(9H-fluoren-9-ylmethoxy)-3-hydroxy-6-methyl-8-oxooctanoic acid |
| (3S,4S)-N-Fmoc-4-amino-3-hydroxy-6-methylheptanoic acid |
| Fmoc-syn-statine |
| (3S,4S)-(9-fluorenylmethoxycarbonyl)-statine |
| (3S,4S)-(9-fluorenylmethoxycarbonyl)-4-amino-3-hydroxy-6-methylheptanoic acid |
| Octanedioic acid, 4-amino-3-hydroxy-6-methyl-, 8-(9H-fluoren-9-ylmethyl) ester |
| (3S,4S)-4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-hydroxy-6-methylheptanoic acid |
| Fmoc-statine |
