Introduction:Basic information about CAS 35726-62-6|N-Cbz-L-glutamic acid 5-ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Cbz-L-glutamic acid 5-ethyl ester |
|---|
| CAS Number | 35726-62-6 | Molecular Weight | 309.31400 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H19NO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N-Cbz-L-glutamic acid 5-ethyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C15H19NO6 |
|---|
| Molecular Weight | 309.31400 |
|---|
| Exact Mass | 309.12100 |
|---|
| PSA | 101.93000 |
|---|
| LogP | 2.10020 |
|---|
| InChIKey | HRFYEAOTNUSCGI-LBPRGKRZSA-N |
|---|
| SMILES | CCOC(=O)CCC(NC(=O)OCc1ccccc1)C(=O)O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Cbz-L-Glu(ET)-OH |
| N-Benzyloxycarbonyl-L-glutaminsaeure-5-aethylester |
| (S)-2-(((Benzyloxy)carbonyl)amino)-5-ethoxy-5-oxopentanoic acid |
| (4S)-4-benzyloxycarbonylamino-4-carbonylpentanoic acid ethyl ester |
| Z-GLU(OET)-OH |
| Z-L-GLU(ET)-OH |
| Cbz-Glu(OEt)-OH |
| (S)-2-(benzyloxycarbonylamino)-5-ethoxy-5-oxopentanoic acid |
| N-benzyloxycarbonyl-L-glutamic acid-5-ethyl ester |
| Z-Glu-Oet |