Introduction：Basic information about CAS 84888-35-7|Boc-Cys(Fm)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-Cys(Fm)-OH |
|---|
| CAS Number | 84888-35-7 | Molecular Weight | 399.50300 |
|---|
| Density | 1.237g/cm3 | Boiling Point | 603.4ºC at 760 mmHg |
|---|
| Molecular Formula | C22H25NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 318.7ºC |
|---|
Names
| Name | (2R)-3-(9H-fluoren-9-ylmethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.237g/cm3 |
|---|
| Boiling Point | 603.4ºC at 760 mmHg |
|---|
| Molecular Formula | C22H25NO4S |
|---|
| Molecular Weight | 399.50300 |
|---|
| Flash Point | 318.7ºC |
|---|
| Exact Mass | 399.15000 |
|---|
| PSA | 100.93000 |
|---|
| LogP | 4.90090 |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | AIZZGGDXFGAYMR-IBGZPJMESA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CSCC1c2ccccc2-c2ccccc21)C(=O)O |
|---|
| Storage condition | -15°C |
|---|
Synonyms
| AmbotzBAA5510 |
| Boc-Cys(Fm)-OH |
| (R)-[(tert-butoxy)carbonyl-S-(9-fluorenylmethyl)]cysteine |
| N-Boc-Cys(Fm)-OH |
| N-Boc-S-Fm-L-cysteine |
| S-(9H-Fluoren-9-ylmethyl)-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-cysteine |
