Introduction：Basic information about CAS 15087-24-8|1,7,7-trimethyl-3-(phenylmethylene)bicyclo[2.2.1]heptan-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,7,7-trimethyl-3-(phenylmethylene)bicyclo[2.2.1]heptan-2-one |
|---|
| CAS Number | 15087-24-8 | Molecular Weight | 240.34000 |
|---|
| Density | 1.079g/cm3 | Boiling Point | 354.5ºC at 760mmHg |
|---|
| Molecular Formula | C17H20O | Melting Point | 97°C (lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 158.2ºC |
|---|
| Symbol |
GHS08 | Signal Word | Warning |
|---|
Names
| Name | benzylidene camphor |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.079g/cm3 |
|---|
| Boiling Point | 354.5ºC at 760mmHg |
|---|
| Melting Point | 97°C (lit.) |
|---|
| Molecular Formula | C17H20O |
|---|
| Molecular Weight | 240.34000 |
|---|
| Flash Point | 158.2ºC |
|---|
| Exact Mass | 240.15100 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.09520 |
|---|
| Vapour Pressure | 3.34E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | OIQXFRANQVWXJF-QBFSEMIESA-N |
|---|
| SMILES | CC12CCC(C(=Cc3ccccc3)C1=O)C2(C)C |
|---|
Safety Information
| Symbol |
GHS08 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H361fd |
|---|
| Precautionary Statements | P281 |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | 63-62 |
|---|
| Safety Phrases | 36/37 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| RTECS | DT5099765 |
|---|
| HS Code | 2914399090 |
|---|
Customs
| HS Code | 2914399090 |
|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| 3-benzylidene-1,7,7-trimethyl-norbornan-2-one |
| Bicyclo2.2.1heptan-2-one,1,7,7-trimethyl-3-(phenylmethylene) |
| 3-benzylidene camphor |
| 1,7,7-trimethyl-3-(phenylmethylene)-bicyclo[2.2.1]heptan-2-on |
| 1,7,7-Trimethyl-3-benzylidenebicyclo[2.2.1]heptane-2-one |
| 3-benzylidene-D,L-camphor |
| 3-Benzylidenecamphor |
| 3-BENZYLIDENE-BORNAN-2-ONE |
| 3-Benzyliden-1,7,7-trimethyl-norbornan-2-on |
| 1,7,7-trimethyl-3-(phenylmethylene)-Bicyclo[2.2.1]heptan-2-one |
| 3-Benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
