Introduction：Basic information about CAS 67990-66-3|Benzoicacid, 2-[(2-amino-4-chlorophenyl)amino]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoicacid, 2-[(2-amino-4-chlorophenyl)amino]- |
|---|
| CAS Number | 67990-66-3 | Molecular Weight | 262.69200 |
|---|
| Density | 1.441g/cm3 | Boiling Point | 442.4ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11ClN2O2 | Melting Point | 191ºC (dec.)(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 221.4ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-(2-amino-4-chloroanilino)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.441g/cm3 |
|---|
| Boiling Point | 442.4ºC at 760 mmHg |
|---|
| Melting Point | 191ºC (dec.)(lit.) |
|---|
| Molecular Formula | C13H11ClN2O2 |
|---|
| Molecular Weight | 262.69200 |
|---|
| Flash Point | 221.4ºC |
|---|
| Exact Mass | 262.05100 |
|---|
| PSA | 75.35000 |
|---|
| LogP | 4.01820 |
|---|
| Index of Refraction | 1.716 |
|---|
| InChIKey | HMVPMZFEYCGSTC-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(Cl)ccc1Nc1ccccc1C(=O)O |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| MFCD00007775 |
| BIDD:GT0706 |
| N-(2-Amino-4-chlorophenyl)anthranilic acid |
| N-(4-chloro-2-aminophenyl)anthranilic acid |
| 2-(2-Amino-4-chlorphenyl)aminobenzencarbonsaeure |
| 2-[(2-amino-4-chlorophenyl)amino]-benzoic acid |
