Introduction:Basic information about CAS 20430-72-2|4-Hydroxy-7-methoxy-2-phenylquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Hydroxy-7-methoxy-2-phenylquinoline |
|---|
| CAS Number | 20430-72-2 | Molecular Weight | 251.28000 |
|---|
| Density | 1.206g/cm3 | Boiling Point | 430.7ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13NO2 | Melting Point | 276 - 277 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 214.3ºC |
|---|
| Symbol | GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | 7-methoxy-2-phenyl-quinolin-4-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.206g/cm3 |
|---|
| Boiling Point | 430.7ºC at 760 mmHg |
|---|
| Melting Point | 276 - 277 °C |
|---|
| Molecular Formula | C16H13NO2 |
|---|
| Molecular Weight | 251.28000 |
|---|
| Flash Point | 214.3ºC |
|---|
| Exact Mass | 251.09500 |
|---|
| PSA | 42.35000 |
|---|
| LogP | 3.61600 |
|---|
| Vapour Pressure | 1.27E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.614 |
|---|
| InChIKey | JZVUAOCDNFNSGQ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2c(=O)cc(-c3ccccc3)[nH]c2c1 |
|---|
Safety Information
| Symbol | GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H318 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| Hazard Codes | C |
|---|
| Risk Phrases | 22-41 |
|---|
| Safety Phrases | 26-39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933499090 |
|---|
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-Phenyl-7-ethoxycarbonyl-1,9a-dihydroxanthen |
| 4-hydroxy-2-phenyl-7-methoxyquinoline |
| 1H-Xanthene-7-carboxylic acid,9,9a-dihydro-2-phenyl-,ethyl ester |
| 7-Methoxy-2-phenyl-chinolin-4-ol |
| 4-hydroxy-7-methoxy-2-phenylquinoline |
| 7-methoxy-2-phenylquinolin-4-ol |
| 2-phenyl-4-hydroxy-7-methoxy-quinoline |
| 7-phenyl-8,8a-dihydro-xanthene-2-carboxylic acid ethyl ester |
| 2-phenyl-7-methoxy-4-quinolinol |