Introduction：Basic information about CAS 1926-49-4|chlomethocillin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | chlomethocillin |
|---|
| CAS Number | 1926-49-4 | Molecular Weight | 433.30600 |
|---|
| Density | 1.54g/cm3 | Boiling Point | 693.1ºC at 760mmHg |
|---|
| Molecular Formula | C17H18Cl2N2O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 373ºC |
|---|
Names
| Name | (2S,5R,6R)-6-[[2-(3,4-dichlorophenyl)-2-methoxyacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.54g/cm3 |
|---|
| Boiling Point | 693.1ºC at 760mmHg |
|---|
| Molecular Formula | C17H18Cl2N2O5S |
|---|
| Molecular Weight | 433.30600 |
|---|
| Flash Point | 373ºC |
|---|
| Exact Mass | 432.03100 |
|---|
| PSA | 121.24000 |
|---|
| LogP | 2.64140 |
|---|
| Vapour Pressure | 3.6E-20mmHg at 25°C |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | JKXQBIZCQJLVOS-GSNLGQFWSA-N |
|---|
| SMILES | COC(C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)O)c1ccc(Cl)c(Cl)c1 |
|---|
Synonyms
| Clometocilina |
| no. 356 |
| Clometocillin |
| Clometocillinum |
| Clometocilline |
| Clometacillin |
| Rixapen |
| Penicilline 356 |
