Introduction：Basic information about CAS 15990-45-1|Benzenemethanol, a-(nitromethyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenemethanol, a-(nitromethyl)- |
|---|
| CAS Number | 15990-45-1 | Molecular Weight | 167.16200 |
|---|
| Density | 1.254g/cm3 | Boiling Point | 317.2ºC at 760mmHg |
|---|
| Molecular Formula | C8H9NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 142.5ºC |
|---|
Names
| Name | 2-nitro-1-phenylethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.254g/cm3 |
|---|
| Boiling Point | 317.2ºC at 760mmHg |
|---|
| Molecular Formula | C8H9NO3 |
|---|
| Molecular Weight | 167.16200 |
|---|
| Flash Point | 142.5ºC |
|---|
| Exact Mass | 167.05800 |
|---|
| PSA | 66.05000 |
|---|
| LogP | 1.51990 |
|---|
| Vapour Pressure | 0.000164mmHg at 25°C |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | XUEWIQNQPBSCOR-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])CC(O)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2906299090 |
|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 2-nitro-1-phenylethan-1-ol |
| 2-phenyl-1-nitro-2-ethanol |
| 2-hydroxy-2-phenyl-nitroethane |
| 1-Phenyl-2-nitroethanol |
| 2-Nitro-1-phenyl-ethanol |
| 2-Nitro-1-phenyl-1-ethanol |
| 1-Phenyl-2-nitroethan-1-ol |
