Introduction：Basic information about CAS 147165-04-6|3-Pyridazinecarboxamide, 6-[[(4-methoxyphenyl)methyl]amino]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Pyridazinecarboxamide, 6-[[(4-methoxyphenyl)methyl]amino]- |
|---|
| CAS Number | 147165-04-6 | Molecular Weight | 258.27600 |
|---|
| Density | 1.299g/cm3 | Boiling Point | 542.6ºC at 760mmHg |
|---|
| Molecular Formula | C13H14N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 281.9ºC |
|---|
Names
| Name | 3-Pyridazinecarboxamide, 6-[[(4-methoxyphenyl)methyl]amino] |
|---|
Chemical & Physical Properties
| Density | 1.299g/cm3 |
|---|
| Boiling Point | 542.6ºC at 760mmHg |
|---|
| Molecular Formula | C13H14N4O2 |
|---|
| Molecular Weight | 258.27600 |
|---|
| Flash Point | 281.9ºC |
|---|
| Exact Mass | 258.11200 |
|---|
| PSA | 90.13000 |
|---|
| LogP | 1.96950 |
|---|
| Vapour Pressure | 7.8E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.646 |
|---|
| InChIKey | VRHOEXVURUSANW-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(CNc2ccc(C(N)=O)nn2)cc1 |
|---|
