Introduction：Basic information about CAS 83732-80-3|Dinatrium-8-hydroxynaphthalen-1,6-disulfonat, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dinatrium-8-hydroxynaphthalen-1,6-disulfonat |
|---|
| CAS Number | 83732-80-3 | Molecular Weight | 348.260 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H6Na2O7S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | disodium,8-hydroxynaphthalene-1,6-disulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H6Na2O7S2 |
|---|
| Molecular Weight | 348.260 |
|---|
| Exact Mass | 347.935028 |
|---|
| PSA | 151.39000 |
|---|
| LogP | 2.51520 |
|---|
| InChIKey | KFHVAHCQOBQJQA-UHFFFAOYSA-L |
|---|
| SMILES | O=S(=O)([O-])c1cc(O)c2c(S(=O)(=O)[O-])cccc2c1.[Na+].[Na+] |
|---|
Safety Information
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1,6-Naphthalenedisulfonic acid, 8-hydroxy-, sodium salt (1:2) |
| Disodium 8-hydroxy-1,6-naphthalenedisulfonate |
| EINECS 280-631-8 |
| Disodium 8-hydroxynaphthalene-1,6-disulfonate |
| Dinatrium-8-hydroxynaphthalen-1,6-disulfonat |
| 1-Naphthol-3,8-disulfonic acid disodium salt |
| disodium 8-hydroxynaphthalene-1,6-disulphonate |
