Introduction:Basic information about CAS 848953-32-2|6-(4-Fluoro-2-methylphenyl)pyridazine-3-carboxylic acid hydrazide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-(4-Fluoro-2-methylphenyl)pyridazine-3-carboxylic acid hydrazide |
|---|
| CAS Number | 848953-32-2 | Molecular Weight | 246.24000 |
|---|
| Density | 1.301g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H11FN4O | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-(4-fluoro-2-methylphenyl)pyridazine-3-carbohydrazide |
|---|
Chemical & Physical Properties
| Density | 1.301g/cm3 |
|---|
| Molecular Formula | C12H11FN4O |
|---|
| Molecular Weight | 246.24000 |
|---|
| Exact Mass | 246.09200 |
|---|
| PSA | 80.90000 |
|---|
| LogP | 2.28580 |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | ROKSYFZHIHRKKT-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(F)ccc1-c1ccc(C(=O)NN)nn1 |
|---|