Introduction:Basic information about CAS 121041-62-1|3-Pyridazinamine, 6-[[(4-methoxyphenyl)methyl]thio]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Pyridazinamine, 6-[[(4-methoxyphenyl)methyl]thio]- |
|---|
| CAS Number | 121041-62-1 | Molecular Weight | 247.31600 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 505.2ºC at 760mmHg |
|---|
| Molecular Formula | C12H13N3OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 259.3ºC |
|---|
Names
| Name | 3-Pyridazinamine, 6-[[(4-methoxyphenyl)methyl]thio] |
|---|
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 505.2ºC at 760mmHg |
|---|
| Molecular Formula | C12H13N3OS |
|---|
| Molecular Weight | 247.31600 |
|---|
| Flash Point | 259.3ºC |
|---|
| Exact Mass | 247.07800 |
|---|
| PSA | 86.33000 |
|---|
| LogP | 2.94090 |
|---|
| Vapour Pressure | 2.48E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.645 |
|---|
| InChIKey | XAMRILMSCLEPCB-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(CSc2ccc(N)nn2)cc1 |
|---|