Introduction：Basic information about CAS 874338-92-8|Benzonitrile, 3-[(6-amino-3-pyridazinyl)methyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzonitrile, 3-[(6-amino-3-pyridazinyl)methyl]- |
|---|
| CAS Number | 874338-92-8 | Molecular Weight | 210.23500 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 478.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 243.4ºC |
|---|
Names
| Name | 3-[(6-aminopyridazin-3-yl)methyl]benzonitrile |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 478.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10N4 |
|---|
| Molecular Weight | 210.23500 |
|---|
| Flash Point | 243.4ºC |
|---|
| Exact Mass | 210.09100 |
|---|
| PSA | 75.59000 |
|---|
| LogP | 2.10248 |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | JFQPJXJTVICMEL-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1cccc(Cc2ccc(N)nn2)c1 |
|---|
