Introduction:Basic information about CAS 913698-77-8|1H-PYRROLO[2,3-B]PYRIDIN-4-OL, 2-(3,4,5-TRIMETHOXYPHENYL)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-PYRROLO[2,3-B]PYRIDIN-4-OL, 2-(3,4,5-TRIMETHOXYPHENYL)- |
|---|
| CAS Number | 913698-77-8 | Molecular Weight | 300.30900 |
|---|
| Density | 1.301g/cm3 | Boiling Point | 514.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1H-Pyrrolo[2,3-b]pyridin-4-ol, 2-(3,4,5-trimethoxyphenyl) |
|---|
Chemical & Physical Properties
| Density | 1.301g/cm3 |
|---|
| Boiling Point | 514.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16N2O4 |
|---|
| Molecular Weight | 300.30900 |
|---|
| Exact Mass | 300.11100 |
|---|
| PSA | 76.60000 |
|---|
| LogP | 2.96130 |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | JZWSUWNGPYUHJT-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(-c2cc3c(=O)cc[nH]c3[nH]2)cc(OC)c1OC |
|---|