Introduction:Basic information about CAS 848953-31-1|6-(4-Fluoro-2-methylphenyl)pyridazine-3-carboxylic acid methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-(4-Fluoro-2-methylphenyl)pyridazine-3-carboxylic acid methyl ester |
|---|
| CAS Number | 848953-31-1 | Molecular Weight | 246.23700 |
|---|
| Density | 1.234g/cm3 | Boiling Point | 403ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11FN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 197.5ºC |
|---|
Names
| Name | methyl 6-(4-fluoro-2-methylphenyl)pyridazine-3-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.234g/cm3 |
|---|
| Boiling Point | 403ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11FN2O2 |
|---|
| Molecular Weight | 246.23700 |
|---|
| Flash Point | 197.5ºC |
|---|
| Exact Mass | 246.08000 |
|---|
| PSA | 52.08000 |
|---|
| LogP | 2.37770 |
|---|
| Index of Refraction | 1.55 |
|---|
| InChIKey | XPQDTSAYPGDQCO-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(-c2ccc(F)cc2C)nn1 |
|---|