Introduction：Basic information about CAS 150969-56-5|5-(Trifluormethyl)indan-1-on, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(Trifluormethyl)indan-1-on |
|---|
| CAS Number | 150969-56-5 | Molecular Weight | 200.157 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 237.1±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H7F3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 95.3±18.8 °C |
|---|
Names
| Name | 5-(Trifluoromethyl)-2,3-dihydro-1H-inden-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 237.1±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H7F3O |
|---|
| Molecular Weight | 200.157 |
|---|
| Flash Point | 95.3±18.8 °C |
|---|
| Exact Mass | 200.044907 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 2.67 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.498 |
|---|
| InChIKey | AHSXMYSALCGWSP-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CCc2cc(C(F)(F)F)ccc21 |
|---|
Safety Information
Synonyms
| 5-(Trifluoromethyl)indan-1-one |
| 5-(Trifluormethyl)-2,3-dihydro-1H-inden-1-on |
| 1H-Inden-1-one, 2,3-dihydro-5-(trifluoromethyl)- |
| 5-(trifluoromethyl)-2,3-dihydroinden-1-one |
| 5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-one |
| 5-Trifluoromethyl-indan-1-one |
| 5-(Trifluormethyl)indan-1-on |
| 5-(Trifluoromethyl)-1-indanone |
