Introduction：Basic information about CAS 401465-33-6|2-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1H-imidazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1H-imidazole |
|---|
| CAS Number | 401465-33-6 | Molecular Weight | 236.26700 |
|---|
| Density | 1.21g/cm3 | Boiling Point | 359.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 171.3ºC |
|---|
Names
| Name | 2-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1H-imidazole |
|---|
Chemical & Physical Properties
| Density | 1.21g/cm3 |
|---|
| Boiling Point | 359.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16N2O3 |
|---|
| Molecular Weight | 236.26700 |
|---|
| Flash Point | 171.3ºC |
|---|
| Exact Mass | 236.11600 |
|---|
| PSA | 52.08000 |
|---|
| LogP | 0.82660 |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | KIIGFSYTKBZATN-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C2=NCCN2)cc(OC)c1OC |
|---|
