Introduction：Basic information about CAS 73758-06-2|Indorenate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Indorenate |
|---|
| CAS Number | 73758-06-2 | Molecular Weight | 248.27800 |
|---|
| Density | 1.243g/cm3 | Boiling Point | 442.8ºC at 760 mmHg |
|---|
| Molecular Formula | C13H16N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 221.6ºC |
|---|
Names
| Name | methyl 3-amino-2-(5-methoxy-1H-indol-3-yl)propanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.243g/cm3 |
|---|
| Boiling Point | 442.8ºC at 760 mmHg |
|---|
| Molecular Formula | C13H16N2O3 |
|---|
| Molecular Weight | 248.27800 |
|---|
| Flash Point | 221.6ºC |
|---|
| Exact Mass | 248.11600 |
|---|
| PSA | 77.34000 |
|---|
| LogP | 2.09210 |
|---|
| Index of Refraction | 1.611 |
|---|
| InChIKey | YFEDJMLMWJSRJJ-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C(CN)c1c[nH]c2ccc(OC)cc12 |
|---|
Synonyms
| Indorenato |
| indorenate |
| Indorenatum |
