Introduction:Basic information about CAS 146374-56-3|ethyl 2-[5,6-dichloro-2-(cyanoamino)-4H-quinazolin-3-yl]acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 2-[5,6-dichloro-2-(cyanoamino)-4H-quinazolin-3-yl]acetate |
|---|
| CAS Number | 146374-56-3 | Molecular Weight | 327.16600 |
|---|
| Density | 1.464g/cm3 | Boiling Point | 466.78ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12Cl2N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 236.101ºC |
|---|
Names
| Name | ethyl 2-[5,6-dichloro-2-(cyanoamino)-4H-quinazolin-3-yl]acetate |
|---|
Chemical & Physical Properties
| Density | 1.464g/cm3 |
|---|
| Boiling Point | 466.78ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12Cl2N4O2 |
|---|
| Molecular Weight | 327.16600 |
|---|
| Flash Point | 236.101ºC |
|---|
| Exact Mass | 326.03400 |
|---|
| PSA | 77.72000 |
|---|
| LogP | 2.69698 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | ZTQFDKVKDGLGQS-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CN1Cc2c(ccc(Cl)c2Cl)N=C1NC#N |
|---|