Introduction：Basic information about CAS 7009-54-3|(1-methylpiperidin-4-yl) 3-methyl-2-phenylpentanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1-methylpiperidin-4-yl) 3-methyl-2-phenylpentanoate |
|---|
| CAS Number | 7009-54-3 | Molecular Weight | 289.41200 |
|---|
| Density | 1.03 g/cm3 | Boiling Point | 370ºC at 760mmHg |
|---|
| Molecular Formula | C18H27NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 113.7ºC |
|---|
Names
| Name | (1-methylpiperidin-4-yl) 3-methyl-2-phenylpentanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.03 g/cm3 |
|---|
| Boiling Point | 370ºC at 760mmHg |
|---|
| Molecular Formula | C18H27NO2 |
|---|
| Molecular Weight | 289.41200 |
|---|
| Flash Point | 113.7ºC |
|---|
| Exact Mass | 289.20400 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 3.39160 |
|---|
| Index of Refraction | 1.527 |
|---|
| InChIKey | UKQYEYCQIQBHBC-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)C(C(=O)OC1CCN(C)CC1)c1ccccc1 |
|---|
Synonyms
| 4-(2-Phenyl-3-methyl-pentanoyloxy)-1-methyl-piperidin |
| Pentapiperida [INN-Spanish] |
| Pentapiperidum |
| Pentapiperidum [INN-Latin] |
| 1-methylpiperidin-4-yl 3-methyl-2-phenylpentanoate |
| Lyspafen,2-Phenyl-3-methylpentansaeure-(1)-1'-methylpiperidyl-(4')-ester |
| 3-Methyl-2-phenyl-pentansaeure-(1)-(1-methyl-piperidyl-(4)-ester) |
| 1-methyl-4-piperidyl 3-methyl-2-phenylvalerate |
| Pentapiperida |
| Pentapiperide |
| EINECS 230-286-4 |
