Introduction:Basic information about CAS 59484-42-3|4-Thiazolol,2,5-diphenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Thiazolol,2,5-diphenyl- |
|---|
| CAS Number | 59484-42-3 | Molecular Weight | 253.31900 |
|---|
| Density | 1.259g/cm3 | Boiling Point | 442.4ºC at 760 mmHg |
|---|
| Molecular Formula | C15H11NOS | Melting Point | 210-212ºC |
|---|
| MSDS | / | Flash Point | 221.4ºC |
|---|
Names
| Name | 2,5-Diphenyl-1,3-thiazol-4-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.259g/cm3 |
|---|
| Boiling Point | 442.4ºC at 760 mmHg |
|---|
| Melting Point | 210-212ºC |
|---|
| Molecular Formula | C15H11NOS |
|---|
| Molecular Weight | 253.31900 |
|---|
| Flash Point | 221.4ºC |
|---|
| Exact Mass | 253.05600 |
|---|
| PSA | 61.36000 |
|---|
| LogP | 4.18270 |
|---|
| Index of Refraction | 1.654 |
|---|
| InChIKey | HICCJUZMDNQOMI-UHFFFAOYSA-N |
|---|
| SMILES | Oc1nc(-c2ccccc2)sc1-c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2934100090 |
|---|
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| diphenyl-1,3-thiazol-4-ol |
| 2,4-DINITROPHENYLHYDRAZINE |
| 4-Hydroxy-2,5-diphenylthiazol |
| 2-Phenyl-4-hydroxy-5-phenylthiazole |
| 2,5-diphenyl-thiazol-4-ol |
| diphenylthiazolol |
| 2,5-diphenyl-4-hydroxythiazole |
| 2,5-diphenyl-thiazol-4-one |
| 4-Thiazolol,2,5-diphenyl |
| 2,5-Diphenyl-4-hydroxy-1,3-thiazole |