Introduction:Basic information about CAS 51254-00-3|4-[(Dimethylamino)methylene]-2-phenyl-1,3-oxazol-5(4H)-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(Dimethylamino)methylene]-2-phenyl-1,3-oxazol-5(4H)-one |
|---|
| CAS Number | 51254-00-3 | Molecular Weight | 216.23600 |
|---|
| Density | 1.16g/cm3 | Boiling Point | 285.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H12N2O2 | Melting Point | 166-169ºC |
|---|
| MSDS | / | Flash Point | 126.5ºC |
|---|
Names
| Name | 4-[(Dimethylamino)methylene]-2-phenyl-1,3-oxazol-5(4H)-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.16g/cm3 |
|---|
| Boiling Point | 285.6ºC at 760mmHg |
|---|
| Melting Point | 166-169ºC |
|---|
| Molecular Formula | C12H12N2O2 |
|---|
| Molecular Weight | 216.23600 |
|---|
| Flash Point | 126.5ºC |
|---|
| Exact Mass | 216.09000 |
|---|
| PSA | 41.90000 |
|---|
| LogP | 0.82860 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | GZJKBFRZBMYLAV-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)C=C1N=C(c2ccccc2)OC1=O |
|---|
Synonyms
| 4-( N,N-dimethylaminomethylene)-2-phenyl-2-oxazolin-5-one |
| 4-(dimethylamino-methylene)-2-phenyl-4H-oxazol-5-one |
| 2-phenyl-4-dimethylaminomethylene-5-oxazolone |
| 4-Dimethylaminomethylene-2-phenyl-5(4H)-oxazolone |