Introduction:Basic information about CAS 15188-09-7|Tris[(2-methyl-2-propanyl)peroxy](vinyl)silane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tris[(2-methyl-2-propanyl)peroxy](vinyl)silane |
|---|
| CAS Number | 15188-09-7 | Molecular Weight | 322.470 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 272.6±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H30O6Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 103.6±23.0 °C |
|---|
Names
| Name | vinyltris(tert-butylperoxy)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 272.6±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H30O6Si |
|---|
| Molecular Weight | 322.470 |
|---|
| Flash Point | 103.6±23.0 °C |
|---|
| Exact Mass | 322.181152 |
|---|
| PSA | 55.38000 |
|---|
| LogP | 8.16 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.435 |
|---|
| InChIKey | WCAGGTLUGWSHOV-UHFFFAOYSA-N |
|---|
| SMILES | C=C[Si](OOC(C)(C)C)(OOC(C)(C)C)OOC(C)(C)C |
|---|
Safety Information
| RIDADR | UN 3101 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 5.2 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| x12-530 |
| tris(tert-butylperoxy)vinylsilane |
| Tri-tert.-butyl-peroxy-vinyl-silan |
| Silane, tris[(1,1-dimethylethyl)dioxy]ethenyl- |
| tris(tert-butyldioxy)vinyl-silan |
| tris(tert-butyldioxy)vinylsilane |
| Tris[(2-methyl-2-propanyl)peroxy](vinyl)silane |
| Tris-(tert.-butylepidioxy)-vinyl-silan |
| vinyltris(tert-butyldioxy)silane |
| vinyltri(tert-butylperoxysilane) |
| inmineralspirits |
| Vinyl-tris-(t-butylperoxy)-silan |
| vinyl tris(t-butylperoxy)silane |
| Einecs 239-238-7 |
| silane32-61 |