Introduction:Basic information about CAS 35978-98-4|H-Lys-Tyr-OH acetate salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | H-Lys-Tyr-OH acetate salt |
|---|
| CAS Number | 35978-98-4 | Molecular Weight | 309.36100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H23N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C15H23N3O4 |
|---|
| Molecular Weight | 309.36100 |
|---|
| Exact Mass | 309.16900 |
|---|
| PSA | 138.67000 |
|---|
| LogP | 1.75190 |
|---|
| InChIKey | MYTOTTSMVMWVJN-STQMWFEESA-N |
|---|
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-L-lysyl-L-tyrosine |
| N-L-Lysyl-L-tyrosin |
| L-lysyl-L-tyrosine |
| L-Tyrosine,L-lysyl |
| L-Lys-L-Tyr |
| Lysyltyrosine |
| L-Lysyl=>L-tyrosin |
| H-Lys-Tyr-OH |