Introduction：Basic information about CAS 402616-41-5|[1,1-Bis(hydroxymethyl)-3-(4-octylphenyl)propyl]carbamic acid Phenylmethyl Es, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [1,1-Bis(hydroxymethyl)-3-(4-octylphenyl)propyl]carbamic acid Phenylmethyl Ester |
|---|
| CAS Number | 402616-41-5 | Molecular Weight | 441.60300 |
|---|
| Density | 1.091g/cm3 | Boiling Point | 624.7ºC at 760 mmHg |
|---|
| Molecular Formula | C27H39NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 331.6ºC |
|---|
Names
| Name | [1,1-Bis(hydroxymethyl)-3-(4-octylphenyl)propyl]carbamic acid Phenylmethyl Ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.091g/cm3 |
|---|
| Boiling Point | 624.7ºC at 760 mmHg |
|---|
| Molecular Formula | C27H39NO4 |
|---|
| Molecular Weight | 441.60300 |
|---|
| Flash Point | 331.6ºC |
|---|
| Exact Mass | 441.28800 |
|---|
| PSA | 78.79000 |
|---|
| LogP | 5.56290 |
|---|
| Index of Refraction | 1.551 |
|---|
| InChIKey | WHZSMGMWROULJR-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCc1ccc(CCC(CO)(CO)NC(=O)OCc2ccccc2)cc1 |
|---|
Synonyms
| benzyl N-[1-hydroxy-2-(hydroxymethyl)-4-(4-octylphenyl)butan-2-yl]carbamate |
