Introduction：Basic information about CAS 68227-78-1|N-(5-chloro-2-methylphenyl)-3-hydroxy-4-[[2-methoxy-5-[(phenylamino)carbonyl]p, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(5-chloro-2-methylphenyl)-3-hydroxy-4-[[2-methoxy-5-[(phenylamino)carbonyl]phenyl]azo]naphthalene-2-carboxamide |
|---|
| CAS Number | 68227-78-1 | Molecular Weight | 565.01800 |
|---|
| Density | 1.31g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C32H25ClN4O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (4Z)-N-(5-chloro-2-methylphenyl)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-3-oxonaphthalene-2-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Molecular Formula | C32H25ClN4O4 |
|---|
| Molecular Weight | 565.01800 |
|---|
| Exact Mass | 564.15600 |
|---|
| PSA | 112.38000 |
|---|
| LogP | 8.58180 |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | WWPCXBSKDSUELS-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(=O)Nc2ccccc2)cc1N=Nc1c(O)c(C(=O)Nc2cc(Cl)ccc2C)cc2ccccc12 |
|---|
